C17H17Cl2NO — CID 115348945
5-chloro-N-(3-chloro-4-ethoxyphenyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 115348945) has the molecular formula C17H17Cl2NO and a molecular weight of 322.24 g/mol. Its IUPAC name is 5-chloro-N-(3-chloro-4-ethoxyphenyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | 5-chloro-N-(3-chloro-4-ethoxyphenyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 115348945 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 5-chloro-N-(3-chloro-4-ethoxyphenyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | CCOc1ccc(NC2Cc3ccc(Cl)cc3C2)cc1Cl |
| InChI | InChI=1S/C17H17Cl2NO/c1-2-21-17-6-5-14(10-16(17)19)20-15-8-11-3-4-13(18)7-12(11)9-15/h3-7,10,15,20H,2,8-9H2,1H3 |
| InChIKey | BRHSLELCGCDEDI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|