C15H13ClN2O2 — CID 115348856
5-chloro-N-(4-nitrophenyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 115348856) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is 5-chloro-N-(4-nitrophenyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | 5-chloro-N-(4-nitrophenyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 115348856 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 5-chloro-N-(4-nitrophenyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NC2Cc3ccc(Cl)cc3C2)cc1 |
| InChI | InChI=1S/C15H13ClN2O2/c16-12-2-1-10-8-14(9-11(10)7-12)17-13-3-5-15(6-4-13)18(19)20/h1-7,14,17H,8-9H2 |
| InChIKey | ZBEVTVNDHDRDPG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|