C34H57NO4 — CID 175168803
[6-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl] N-hexanoylcarbamate (PubChem CID 175168803) has the molecular formula C34H57NO4 and a molecular weight of 543.83 g/mol. Its IUPAC name is [6-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl] N-hexanoylcarbamate.
| Compound Name | [6-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl] N-hexanoylcarbamate |
|---|---|
| PubChem CID | 175168803 |
| Molecular Formula | C34H57NO4 |
| Molecular Weight | 543.83 g/mol |
| Exact Mass | 543.43 |
| IUPAC Name | [6-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptyl] N-hexanoylcarbamate |
| SMILES | CCCCCC(=O)NC(=O)OCC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H57NO4/c1-6-7-8-12-31(37)35-32(38)39-22-23(2)10-9-11-24(3)28-15-16-29-27-14-13-25-21-26(36)17-19-33(25,4)30(27)18-20-34(28,29)5/h13,23-24,26-30,36H,6-12,14-22H2,1-5H3,(H,35,37,38)/t23?,24?,26-,27-,28+,29-,30-,33-,34+/m0/s1 |
| InChIKey | PGTOGLBCPZYDAG-RQCUVBJLSA-N |
| XLogP | 8.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.83 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|