C20H25ClFN — CID 175168878
2-cyclopropyl-1-(3-fluoro-4-methylphenyl)-N-(1-phenylethyl)ethanamine;hydrochloride (PubChem CID 175168878) has the molecular formula C20H25ClFN and a molecular weight of 333.88 g/mol. Its IUPAC name is 2-cyclopropyl-1-(3-fluoro-4-methylphenyl)-N-(1-phenylethyl)ethanamine;hydrochloride.
| Compound Name | 2-cyclopropyl-1-(3-fluoro-4-methylphenyl)-N-(1-phenylethyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 175168878 |
| Molecular Formula | C20H25ClFN |
| Molecular Weight | 333.88 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-cyclopropyl-1-(3-fluoro-4-methylphenyl)-N-(1-phenylethyl)ethanamine;hydrochloride |
| SMILES | Cc1ccc(C(CC2CC2)NC(C)c2ccccc2)cc1F.Cl |
| InChI | InChI=1S/C20H24FN.ClH/c1-14-8-11-18(13-19(14)21)20(12-16-9-10-16)22-15(2)17-6-4-3-5-7-17;/h3-8,11,13,15-16,20,22H,9-10,12H2,1-2H3;1H |
| InChIKey | KPBOQQVYTIMFFU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.88 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |