C24H25N7O2 — CID 175169105
N-[4-(2-methoxyphenoxy)pyrimidin-2-yl]-4-(4-methylpiperazin-1-yl)quinazolin-7-amine (PubChem CID 175169105) has the molecular formula C24H25N7O2 and a molecular weight of 443.51 g/mol. Its IUPAC name is N-[4-(2-methoxyphenoxy)pyrimidin-2-yl]-4-(4-methylpiperazin-1-yl)quinazolin-7-amine.
| Compound Name | N-[4-(2-methoxyphenoxy)pyrimidin-2-yl]-4-(4-methylpiperazin-1-yl)quinazolin-7-amine |
|---|---|
| PubChem CID | 175169105 |
| Molecular Formula | C24H25N7O2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-[4-(2-methoxyphenoxy)pyrimidin-2-yl]-4-(4-methylpiperazin-1-yl)quinazolin-7-amine |
| SMILES | COc1ccccc1Oc1ccnc(Nc2ccc3c(N4CCN(C)CC4)ncnc3c2)n1 |
| InChI | InChI=1S/C24H25N7O2/c1-30-11-13-31(14-12-30)23-18-8-7-17(15-19(18)26-16-27-23)28-24-25-10-9-22(29-24)33-21-6-4-3-5-20(21)32-2/h3-10,15-16H,11-14H2,1-2H3,(H,25,28,29) |
| InChIKey | LFOBAWBWVXSFLD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |