About 1-but-1-enoxybut-1-ene;dibutyltin
1-but-1-enoxybut-1-ene;dibutyltin (PubChem CID 175169500) has the molecular formula C16H32OSn
and a molecular weight of 359.14 g/mol. Its IUPAC name is 1-but-1-enoxybut-1-ene;dibutyltin.
Molecular Properties
| Compound Name | 1-but-1-enoxybut-1-ene;dibutyltin |
| PubChem CID | 175169500 |
| Molecular Formula | C16H32OSn |
| Molecular Weight | 359.14 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-but-1-enoxybut-1-ene;dibutyltin |
| SMILES | CCC=COC=CCC.CCCC[Sn]CCCC |
| InChI | InChI=1S/C8H14O.2C4H9.Sn/c1-3-5-7-9-8-6-4-2;2*1-3-4-2;/h5-8H,3-4H2,1-2H3;2*1,3-4H2,2H3; |
| InChIKey | VPRHXOBFAYNNHG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.14 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-but-1-enoxybut-1-ene;dibutyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-1-enoxybut-1-ene;dibutyltin?
The IUPAC name of 1-but-1-enoxybut-1-ene;dibutyltin (CID 175169500) is 1-but-1-enoxybut-1-ene;dibutyltin.
What is the SMILES notation for 1-but-1-enoxybut-1-ene;dibutyltin?
The canonical SMILES for 1-but-1-enoxybut-1-ene;dibutyltin is CCC=COC=CCC.CCCC[Sn]CCCC.
What is the InChIKey of 1-but-1-enoxybut-1-ene;dibutyltin?
The InChIKey is VPRHXOBFAYNNHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.2C4H9.Sn/c1-3-5-7-9-8-6-4-2;2*1-3-4-2;/h5-8H,3-4H2,1-2H3;2*1,3-4H2,2H3;.
What are the key properties of 1-but-1-enoxybut-1-ene;dibutyltin?
1-but-1-enoxybut-1-ene;dibutyltin has a molecular weight of 359.14 g/mol, XLogP of 5.98, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-1-enoxybut-1-ene;dibutyltin is sourced from PubChem (CID 175169500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).