About CID 159910043
CID 159910043 (PubChem CID 159910043) has the molecular formula C10H21O2Sn2
and a molecular weight of 410.70 g/mol.
Molecular Properties
| Compound Name | CID 159910043 |
| PubChem CID | 159910043 |
| Molecular Formula | C10H21O2Sn2 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | — |
| SMILES | CC(=O)O[Sn].CCCC[Sn]CCCC |
| InChI | InChI=1S/2C4H9.C2H4O2.2Sn/c2*1-3-4-2;1-2(3)4;;/h2*1,3-4H2,2H3;1H3,(H,3,4);;/q;;;;+1/p-1 |
| InChIKey | VBJGWPNPTPXSSC-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 159910043 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159910043?
The IUPAC name of CID 159910043 (CID 159910043) is not available.
What is the SMILES notation for CID 159910043?
The canonical SMILES for CID 159910043 is CC(=O)O[Sn].CCCC[Sn]CCCC.
What is the InChIKey of CID 159910043?
The InChIKey is VBJGWPNPTPXSSC-UHFFFAOYSA-M. The full InChI is InChI=1S/2C4H9.C2H4O2.2Sn/c2*1-3-4-2;1-2(3)4;;/h2*1,3-4H2,2H3;1H3,(H,3,4);;/q;;;;+1/p-1.
What are the key properties of CID 159910043?
CID 159910043 has a molecular weight of 410.70 g/mol, XLogP of 2.76, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159910043 is sourced from PubChem (CID 159910043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).