About acetyl 2,4-dioxopentanoate;dibutyltin
acetyl 2,4-dioxopentanoate;dibutyltin (PubChem CID 175430197) has the molecular formula C15H26O5Sn
and a molecular weight of 405.08 g/mol. Its IUPAC name is acetyl 2,4-dioxopentanoate;dibutyltin.
Molecular Properties
| Compound Name | acetyl 2,4-dioxopentanoate;dibutyltin |
| PubChem CID | 175430197 |
| Molecular Formula | C15H26O5Sn |
| Molecular Weight | 405.08 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | acetyl 2,4-dioxopentanoate;dibutyltin |
| SMILES | CC(=O)CC(=O)C(=O)OC(C)=O.CCCC[Sn]CCCC |
| InChI | InChI=1S/C7H8O5.2C4H9.Sn/c1-4(8)3-6(10)7(11)12-5(2)9;2*1-3-4-2;/h3H2,1-2H3;2*1,3-4H2,2H3; |
| InChIKey | HPINCDOYUAHYPU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.08 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze acetyl 2,4-dioxopentanoate;dibutyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl 2,4-dioxopentanoate;dibutyltin?
The IUPAC name of acetyl 2,4-dioxopentanoate;dibutyltin (CID 175430197) is acetyl 2,4-dioxopentanoate;dibutyltin.
What is the SMILES notation for acetyl 2,4-dioxopentanoate;dibutyltin?
The canonical SMILES for acetyl 2,4-dioxopentanoate;dibutyltin is CC(=O)CC(=O)C(=O)OC(C)=O.CCCC[Sn]CCCC.
What is the InChIKey of acetyl 2,4-dioxopentanoate;dibutyltin?
The InChIKey is HPINCDOYUAHYPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O5.2C4H9.Sn/c1-4(8)3-6(10)7(11)12-5(2)9;2*1-3-4-2;/h3H2,1-2H3;2*1,3-4H2,2H3;.
What are the key properties of acetyl 2,4-dioxopentanoate;dibutyltin?
acetyl 2,4-dioxopentanoate;dibutyltin has a molecular weight of 405.08 g/mol, XLogP of 2.75, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl 2,4-dioxopentanoate;dibutyltin is sourced from PubChem (CID 175430197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).