C40H78O11 — CID 175169918
1-[2,3-bis(pentylperoxy)non-2-enoxymethoxymethoxy]-2,3-bis(pentylperoxy)non-2-ene (PubChem CID 175169918) has the molecular formula C40H78O11 and a molecular weight of 735.05 g/mol. Its IUPAC name is 1-[2,3-bis(pentylperoxy)non-2-enoxymethoxymethoxy]-2,3-bis(pentylperoxy)non-2-ene.
| Compound Name | 1-[2,3-bis(pentylperoxy)non-2-enoxymethoxymethoxy]-2,3-bis(pentylperoxy)non-2-ene |
|---|---|
| PubChem CID | 175169918 |
| Molecular Formula | C40H78O11 |
| Molecular Weight | 735.05 g/mol |
| Exact Mass | 734.55 |
| IUPAC Name | 1-[2,3-bis(pentylperoxy)non-2-enoxymethoxymethoxy]-2,3-bis(pentylperoxy)non-2-ene |
| SMILES | CCCCCCC(OOCCCCC)=C(COCOCOCC(OOCCCCC)=C(CCCCCC)OOCCCCC)OOCCCCC |
| InChI | InChI=1S/C40H78O11/c1-7-13-19-21-27-37(48-44-29-23-15-9-3)39(50-46-31-25-17-11-5)33-41-35-43-36-42-34-40(51-47-32-26-18-12-6)38(28-22-20-14-8-2)49-45-30-24-16-10-4/h7-36H2,1-6H3 |
| InChIKey | LBXINXLNGVNYMI-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.05 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|