C32H62O7 — CID 175171345
1-(2,3-diethoxyundec-2-enoxymethoxymethoxy)-2,3-diethoxyundec-2-ene (PubChem CID 175171345) has the molecular formula C32H62O7 and a molecular weight of 558.84 g/mol. Its IUPAC name is 1-(2,3-diethoxyundec-2-enoxymethoxymethoxy)-2,3-diethoxyundec-2-ene.
| Compound Name | 1-(2,3-diethoxyundec-2-enoxymethoxymethoxy)-2,3-diethoxyundec-2-ene |
|---|---|
| PubChem CID | 175171345 |
| Molecular Formula | C32H62O7 |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 558.45 |
| IUPAC Name | 1-(2,3-diethoxyundec-2-enoxymethoxymethoxy)-2,3-diethoxyundec-2-ene |
| SMILES | CCCCCCCCC(OCC)=C(COCOCOCC(OCC)=C(CCCCCCCC)OCC)OCC |
| InChI | InChI=1S/C32H62O7/c1-7-13-15-17-19-21-23-29(36-9-3)31(38-11-5)25-33-27-35-28-34-26-32(39-12-6)30(37-10-4)24-22-20-18-16-14-8-2/h7-28H2,1-6H3 |
| InChIKey | JSZBHPAFADVKMC-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|