C18H34O7 — CID 175164011
1-(2,3-dimethoxyhex-2-enoxymethoxymethoxy)-2,3-dimethoxyhex-2-ene (PubChem CID 175164011) has the molecular formula C18H34O7 and a molecular weight of 362.46 g/mol. Its IUPAC name is 1-(2,3-dimethoxyhex-2-enoxymethoxymethoxy)-2,3-dimethoxyhex-2-ene.
| Compound Name | 1-(2,3-dimethoxyhex-2-enoxymethoxymethoxy)-2,3-dimethoxyhex-2-ene |
|---|---|
| PubChem CID | 175164011 |
| Molecular Formula | C18H34O7 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 1-(2,3-dimethoxyhex-2-enoxymethoxymethoxy)-2,3-dimethoxyhex-2-ene |
| SMILES | CCCC(OC)=C(COCOCOCC(OC)=C(CCC)OC)OC |
| InChI | InChI=1S/C18H34O7/c1-7-9-15(19-3)17(21-5)11-23-13-25-14-24-12-18(22-6)16(20-4)10-8-2/h7-14H2,1-6H3 |
| InChIKey | FVYHDVWRECPABU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|