C28H29N3O4 — CID 175171314
N-[2-[[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dihydroindole-1-carbonyl]phenyl]methylamino]ethyl]acetamide (PubChem CID 175171314) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[2-[[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dihydroindole-1-carbonyl]phenyl]methylamino]ethyl]acetamide.
| Compound Name | N-[2-[[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dihydroindole-1-carbonyl]phenyl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 175171314 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-[2-[[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dihydroindole-1-carbonyl]phenyl]methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1ccc(C(=O)N2CCc3c(-c4ccc5c(c4)OCCO5)cccc32)cc1 |
| InChI | InChI=1S/C28H29N3O4/c1-19(32)30-13-12-29-18-20-5-7-21(8-6-20)28(33)31-14-11-24-23(3-2-4-25(24)31)22-9-10-26-27(17-22)35-16-15-34-26/h2-10,17,29H,11-16,18H2,1H3,(H,30,32) |
| InChIKey | LROTYDMXHGUUCY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|