About 2-(1-aminopyrrolo[2,3-b]pyridin-5-yl)acetonitrile
2-(1-aminopyrrolo[2,3-b]pyridin-5-yl)acetonitrile (PubChem CID 175174635) has the molecular formula C9H8N4
and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-(1-aminopyrrolo[2,3-b]pyridin-5-yl)acetonitrile.
Analyze 2-(1-aminopyrrolo[2,3-b]pyridin-5-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-aminopyrrolo[2,3-b]pyridin-5-yl)acetonitrile?
The IUPAC name of 2-(1-aminopyrrolo[2,3-b]pyridin-5-yl)acetonitrile (CID 175174635) is 2-(1-aminopyrrolo[2,3-b]pyridin-5-yl)acetonitrile.
What is the SMILES notation for 2-(1-aminopyrrolo[2,3-b]pyridin-5-yl)acetonitrile?
The canonical SMILES for 2-(1-aminopyrrolo[2,3-b]pyridin-5-yl)acetonitrile is N#CCc1cnc2c(ccn2N)c1.
What is the InChIKey of 2-(1-aminopyrrolo[2,3-b]pyridin-5-yl)acetonitrile?
The InChIKey is IWYVFNUDKHNWII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4/c10-3-1-7-5-8-2-4-13(11)9(8)12-6-7/h2,4-6H,1,11H2.
What are the key properties of 2-(1-aminopyrrolo[2,3-b]pyridin-5-yl)acetonitrile?
2-(1-aminopyrrolo[2,3-b]pyridin-5-yl)acetonitrile has a molecular weight of 172.19 g/mol, XLogP of 0.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminopyrrolo[2,3-b]pyridin-5-yl)acetonitrile is sourced from PubChem (CID 175174635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).