About CID 175175444
CID 175175444 (PubChem CID 175175444) has the molecular formula C11H15O2Si
and a molecular weight of 207.33 g/mol.
Molecular Properties
| Compound Name | CID 175175444 |
| PubChem CID | 175175444 |
| Molecular Formula | C11H15O2Si |
| Molecular Weight | 207.33 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | — |
| SMILES | CCC(CC)Oc1ccccc1O[Si] |
| InChI | InChI=1S/C11H15O2Si/c1-3-9(4-2)12-10-7-5-6-8-11(10)13-14/h5-9H,3-4H2,1-2H3 |
| InChIKey | XINPLKBOKFEHNG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175175444 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175175444?
The IUPAC name of CID 175175444 (CID 175175444) is not available.
What is the SMILES notation for CID 175175444?
The canonical SMILES for CID 175175444 is CCC(CC)Oc1ccccc1O[Si].
What is the InChIKey of CID 175175444?
The InChIKey is XINPLKBOKFEHNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15O2Si/c1-3-9(4-2)12-10-7-5-6-8-11(10)13-14/h5-9H,3-4H2,1-2H3.
What are the key properties of CID 175175444?
CID 175175444 has a molecular weight of 207.33 g/mol, XLogP of 2.72, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175175444 is sourced from PubChem (CID 175175444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).