About pentoxy(diphenyl)methanol;phosphane
pentoxy(diphenyl)methanol;phosphane (PubChem CID 175176254) has the molecular formula C18H25O2P
and a molecular weight of 304.37 g/mol. Its IUPAC name is pentoxy(diphenyl)methanol;phosphane.
Molecular Properties
| Compound Name | pentoxy(diphenyl)methanol;phosphane |
| PubChem CID | 175176254 |
| Molecular Formula | C18H25O2P |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | pentoxy(diphenyl)methanol;phosphane |
| SMILES | CCCCCOC(O)(c1ccccc1)c1ccccc1.P |
| InChI | InChI=1S/C18H22O2.H3P/c1-2-3-10-15-20-18(19,16-11-6-4-7-12-16)17-13-8-5-9-14-17;/h4-9,11-14,19H,2-3,10,15H2,1H3;1H3 |
| InChIKey | QUPQZNGULNDPMC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pentoxy(diphenyl)methanol;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentoxy(diphenyl)methanol;phosphane?
The IUPAC name of pentoxy(diphenyl)methanol;phosphane (CID 175176254) is pentoxy(diphenyl)methanol;phosphane.
What is the SMILES notation for pentoxy(diphenyl)methanol;phosphane?
The canonical SMILES for pentoxy(diphenyl)methanol;phosphane is CCCCCOC(O)(c1ccccc1)c1ccccc1.P.
What is the InChIKey of pentoxy(diphenyl)methanol;phosphane?
The InChIKey is QUPQZNGULNDPMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O2.H3P/c1-2-3-10-15-20-18(19,16-11-6-4-7-12-16)17-13-8-5-9-14-17;/h4-9,11-14,19H,2-3,10,15H2,1H3;1H3.
What are the key properties of pentoxy(diphenyl)methanol;phosphane?
pentoxy(diphenyl)methanol;phosphane has a molecular weight of 304.37 g/mol, XLogP of 4.14, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentoxy(diphenyl)methanol;phosphane is sourced from PubChem (CID 175176254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).