C23H28O4 — CID 154411602
4-hexoxy-5-oxo-4,5-diphenylpentanoic acid (PubChem CID 154411602) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 4-hexoxy-5-oxo-4,5-diphenylpentanoic acid.
| Compound Name | 4-hexoxy-5-oxo-4,5-diphenylpentanoic acid |
|---|---|
| PubChem CID | 154411602 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 4-hexoxy-5-oxo-4,5-diphenylpentanoic acid |
| SMILES | CCCCCCOC(CCC(=O)O)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28O4/c1-2-3-4-11-18-27-23(17-16-21(24)25,20-14-9-6-10-15-20)22(26)19-12-7-5-8-13-19/h5-10,12-15H,2-4,11,16-18H2,1H3,(H,24,25) |
| InChIKey | GLPHUEAQQZCEPS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|