C19H23NO2 — CID 67632369
2-(2-aminoethoxy)-1,2-diphenylpentan-1-one (PubChem CID 67632369) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-1,2-diphenylpentan-1-one.
| Compound Name | 2-(2-aminoethoxy)-1,2-diphenylpentan-1-one |
|---|---|
| PubChem CID | 67632369 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-(2-aminoethoxy)-1,2-diphenylpentan-1-one |
| SMILES | CCCC(OCCN)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-2-13-19(22-15-14-20,17-11-7-4-8-12-17)18(21)16-9-5-3-6-10-16/h3-12H,2,13-15,20H2,1H3 |
| InChIKey | DQTHNPFQWYXKRF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |