C25H34O5S — CID 87118727
(3-hydroxy-1-oxo-1,2-diphenylpropan-2-yl) decane-1-sulfonate (PubChem CID 87118727) has the molecular formula C25H34O5S and a molecular weight of 446.61 g/mol. Its IUPAC name is (3-hydroxy-1-oxo-1,2-diphenylpropan-2-yl) decane-1-sulfonate.
| Compound Name | (3-hydroxy-1-oxo-1,2-diphenylpropan-2-yl) decane-1-sulfonate |
|---|---|
| PubChem CID | 87118727 |
| Molecular Formula | C25H34O5S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (3-hydroxy-1-oxo-1,2-diphenylpropan-2-yl) decane-1-sulfonate |
| SMILES | CCCCCCCCCCS(=O)(=O)OC(CO)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H34O5S/c1-2-3-4-5-6-7-8-15-20-31(28,29)30-25(21-26,23-18-13-10-14-19-23)24(27)22-16-11-9-12-17-22/h9-14,16-19,26H,2-8,15,20-21H2,1H3 |
| InChIKey | IZLMQGMGXJSSEN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|