About acetic acid;dioctyl hydrogen phosphate
acetic acid;dioctyl hydrogen phosphate (PubChem CID 175176967) has the molecular formula C18H39O6P
and a molecular weight of 382.48 g/mol. Its IUPAC name is acetic acid;dioctyl hydrogen phosphate.
Molecular Properties
| Compound Name | acetic acid;dioctyl hydrogen phosphate |
| PubChem CID | 175176967 |
| Molecular Formula | C18H39O6P |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | acetic acid;dioctyl hydrogen phosphate |
| SMILES | CC(=O)O.CCCCCCCCOP(=O)(O)OCCCCCCCC |
| InChI | InChI=1S/C16H35O4P.C2H4O2/c1-3-5-7-9-11-13-15-19-21(17,18)20-16-14-12-10-8-6-4-2;1-2(3)4/h3-16H2,1-2H3,(H,17,18);1H3,(H,3,4) |
| InChIKey | BLHAWWIVIIPLQJ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;dioctyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;dioctyl hydrogen phosphate?
The IUPAC name of acetic acid;dioctyl hydrogen phosphate (CID 175176967) is acetic acid;dioctyl hydrogen phosphate.
What is the SMILES notation for acetic acid;dioctyl hydrogen phosphate?
The canonical SMILES for acetic acid;dioctyl hydrogen phosphate is CC(=O)O.CCCCCCCCOP(=O)(O)OCCCCCCCC.
What is the InChIKey of acetic acid;dioctyl hydrogen phosphate?
The InChIKey is BLHAWWIVIIPLQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35O4P.C2H4O2/c1-3-5-7-9-11-13-15-19-21(17,18)20-16-14-12-10-8-6-4-2;1-2(3)4/h3-16H2,1-2H3,(H,17,18);1H3,(H,3,4).
What are the key properties of acetic acid;dioctyl hydrogen phosphate?
acetic acid;dioctyl hydrogen phosphate has a molecular weight of 382.48 g/mol, XLogP of 5.93, 16 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;dioctyl hydrogen phosphate is sourced from PubChem (CID 175176967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).