About dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate
dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate (PubChem CID 87504266) has the molecular formula C16H37O7PZr
and a molecular weight of 463.66 g/mol. Its IUPAC name is dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate.
Molecular Properties
| Compound Name | dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate |
| PubChem CID | 87504266 |
| Molecular Formula | C16H37O7PZr |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate |
| SMILES | CCCCCCCCOP(=O)(O)OCCCCCCCC.O=[Zr](O)O |
| InChI | InChI=1S/C16H35O4P.2H2O.O.Zr/c1-3-5-7-9-11-13-15-19-21(17,18)20-16-14-12-10-8-6-4-2;;;;/h3-16H2,1-2H3,(H,17,18);2*1H2;;/q;;;;+2/p-2 |
| InChIKey | MALVCCGSLQWVAQ-UHFFFAOYSA-L |
| XLogP | 4.61 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate?
The IUPAC name of dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate (CID 87504266) is dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate.
What is the SMILES notation for dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate?
The canonical SMILES for dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate is CCCCCCCCOP(=O)(O)OCCCCCCCC.O=[Zr](O)O.
What is the InChIKey of dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate?
The InChIKey is MALVCCGSLQWVAQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H35O4P.2H2O.O.Zr/c1-3-5-7-9-11-13-15-19-21(17,18)20-16-14-12-10-8-6-4-2;;;;/h3-16H2,1-2H3,(H,17,18);2*1H2;;/q;;;;+2/p-2.
What are the key properties of dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate?
dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate has a molecular weight of 463.66 g/mol, XLogP of 4.61, 16 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)zirconium;dioctyl hydrogen phosphate is sourced from PubChem (CID 87504266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).