C34H66O7 — CID 175177135
1-(2,3-diethoxy-1-pentoxyoct-2-enoxy)-2,3-diethoxy-1-pentoxyoct-2-ene (PubChem CID 175177135) has the molecular formula C34H66O7 and a molecular weight of 586.90 g/mol. Its IUPAC name is 1-(2,3-diethoxy-1-pentoxyoct-2-enoxy)-2,3-diethoxy-1-pentoxyoct-2-ene.
| Compound Name | 1-(2,3-diethoxy-1-pentoxyoct-2-enoxy)-2,3-diethoxy-1-pentoxyoct-2-ene |
|---|---|
| PubChem CID | 175177135 |
| Molecular Formula | C34H66O7 |
| Molecular Weight | 586.90 g/mol |
| Exact Mass | 586.48 |
| IUPAC Name | 1-(2,3-diethoxy-1-pentoxyoct-2-enoxy)-2,3-diethoxy-1-pentoxyoct-2-ene |
| SMILES | CCCCCOC(OC(OCCCCC)C(OCC)=C(CCCCC)OCC)C(OCC)=C(CCCCC)OCC |
| InChI | InChI=1S/C34H66O7/c1-9-17-21-25-29(35-13-5)31(37-15-7)33(39-27-23-19-11-3)41-34(40-28-24-20-12-4)32(38-16-8)30(36-14-6)26-22-18-10-2/h33-34H,9-28H2,1-8H3 |
| InChIKey | HLDZJHHFMALUPC-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.90 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|