C42H82O7 — CID 175177310
2,3-dibutoxy-1-(2,3-dibutoxy-1-pentoxyoct-2-enoxy)-1-pentoxyoct-2-ene (PubChem CID 175177310) has the molecular formula C42H82O7 and a molecular weight of 699.11 g/mol. Its IUPAC name is 2,3-dibutoxy-1-(2,3-dibutoxy-1-pentoxyoct-2-enoxy)-1-pentoxyoct-2-ene.
| Compound Name | 2,3-dibutoxy-1-(2,3-dibutoxy-1-pentoxyoct-2-enoxy)-1-pentoxyoct-2-ene |
|---|---|
| PubChem CID | 175177310 |
| Molecular Formula | C42H82O7 |
| Molecular Weight | 699.11 g/mol |
| Exact Mass | 698.61 |
| IUPAC Name | 2,3-dibutoxy-1-(2,3-dibutoxy-1-pentoxyoct-2-enoxy)-1-pentoxyoct-2-ene |
| SMILES | CCCCCOC(OC(OCCCCC)C(OCCCC)=C(CCCCC)OCCCC)C(OCCCC)=C(CCCCC)OCCCC |
| InChI | InChI=1S/C42H82O7/c1-9-17-25-29-37(43-31-21-13-5)39(45-33-23-15-7)41(47-35-27-19-11-3)49-42(48-36-28-20-12-4)40(46-34-24-16-8)38(30-26-18-10-2)44-32-22-14-6/h41-42H,9-36H2,1-8H3 |
| InChIKey | UCXKLUKWCKIAGQ-UHFFFAOYSA-N |
| XLogP | 12.92 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.11 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|