C17H40N2OSi — CID 175179221
N'-(6-methyl-5-propan-2-yl-5-silyloxyheptyl)hexane-1,6-diamine (PubChem CID 175179221) has the molecular formula C17H40N2OSi and a molecular weight of 316.61 g/mol. Its IUPAC name is N'-(6-methyl-5-propan-2-yl-5-silyloxyheptyl)hexane-1,6-diamine.
| Compound Name | N'-(6-methyl-5-propan-2-yl-5-silyloxyheptyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 175179221 |
| Molecular Formula | C17H40N2OSi |
| Molecular Weight | 316.61 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | N'-(6-methyl-5-propan-2-yl-5-silyloxyheptyl)hexane-1,6-diamine |
| SMILES | CC(C)C(CCCCNCCCCCCN)(O[SiH3])C(C)C |
| InChI | InChI=1S/C17H40N2OSi/c1-15(2)17(20-21,16(3)4)11-7-10-14-19-13-9-6-5-8-12-18/h15-16,19H,5-14,18H2,1-4,21H3 |
| InChIKey | SHFOYFWGFSLNNT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.61 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|