C14H16O8P2 — CID 175180083
[2-hydroxy-1-[hydroxy(phenyl)phosphoryl]oxyethyl]peroxy-phenylphosphinic acid (PubChem CID 175180083) has the molecular formula C14H16O8P2 and a molecular weight of 374.22 g/mol. Its IUPAC name is [2-hydroxy-1-[hydroxy(phenyl)phosphoryl]oxyethyl]peroxy-phenylphosphinic acid.
| Compound Name | [2-hydroxy-1-[hydroxy(phenyl)phosphoryl]oxyethyl]peroxy-phenylphosphinic acid |
|---|---|
| PubChem CID | 175180083 |
| Molecular Formula | C14H16O8P2 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | [2-hydroxy-1-[hydroxy(phenyl)phosphoryl]oxyethyl]peroxy-phenylphosphinic acid |
| SMILES | O=P(O)(OOC(CO)OP(=O)(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H16O8P2/c15-11-14(21-23(16,17)12-7-3-1-4-8-12)20-22-24(18,19)13-9-5-2-6-10-13/h1-10,14-15H,11H2,(H,16,17)(H,18,19) |
| InChIKey | AXRQAEXFVCZLLY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|