About 4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid
4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid (PubChem CID 175180139) has the molecular formula C10H18ClNO3
and a molecular weight of 235.71 g/mol. Its IUPAC name is 4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid.
Molecular Properties
| Compound Name | 4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid |
| PubChem CID | 175180139 |
| Molecular Formula | C10H18ClNO3 |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid |
| SMILES | CCC(=O)O.O=C1CNCC1CCCCl |
| InChI | InChI=1S/C7H12ClNO.C3H6O2/c8-3-1-2-6-4-9-5-7(6)10;1-2-3(4)5/h6,9H,1-5H2;2H2,1H3,(H,4,5) |
| InChIKey | LKZXWGZFEOOUEF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid?
The IUPAC name of 4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid (CID 175180139) is 4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid.
What is the SMILES notation for 4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid?
The canonical SMILES for 4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid is CCC(=O)O.O=C1CNCC1CCCCl.
What is the InChIKey of 4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid?
The InChIKey is LKZXWGZFEOOUEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClNO.C3H6O2/c8-3-1-2-6-4-9-5-7(6)10;1-2-3(4)5/h6,9H,1-5H2;2H2,1H3,(H,4,5).
What are the key properties of 4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid?
4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid has a molecular weight of 235.71 g/mol, XLogP of 1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloropropyl)pyrrolidin-3-one;propanoic acid is sourced from PubChem (CID 175180139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).