About 4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate
4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate (PubChem CID 175195273) has the molecular formula C10H18ClNO3
and a molecular weight of 235.71 g/mol. Its IUPAC name is 4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate.
Molecular Properties
| Compound Name | 4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate |
| PubChem CID | 175195273 |
| Molecular Formula | C10H18ClNO3 |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate |
| SMILES | CCOC=O.O=C1CNCC1CCCCl |
| InChI | InChI=1S/C7H12ClNO.C3H6O2/c8-3-1-2-6-4-9-5-7(6)10;1-2-5-3-4/h6,9H,1-5H2;3H,2H2,1H3 |
| InChIKey | KDXBJFFKMXOQRL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate?
The IUPAC name of 4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate (CID 175195273) is 4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate.
What is the SMILES notation for 4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate?
The canonical SMILES for 4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate is CCOC=O.O=C1CNCC1CCCCl.
What is the InChIKey of 4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate?
The InChIKey is KDXBJFFKMXOQRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClNO.C3H6O2/c8-3-1-2-6-4-9-5-7(6)10;1-2-5-3-4/h6,9H,1-5H2;3H,2H2,1H3.
What are the key properties of 4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate?
4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate has a molecular weight of 235.71 g/mol, XLogP of 0.97, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloropropyl)pyrrolidin-3-one;ethyl formate is sourced from PubChem (CID 175195273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).