C30H40BBrN2O12 — CID 175181327
3-[2-[2-(bromomethyl)-3-cyano-5-nitrophenyl]-4,5,5-tris(1-carboxybutan-2-yl)-1,3,2-dioxaborolan-4-yl]pentanoic acid (PubChem CID 175181327) has the molecular formula C30H40BBrN2O12 and a molecular weight of 711.37 g/mol. Its IUPAC name is 3-[2-[2-(bromomethyl)-3-cyano-5-nitrophenyl]-4,5,5-tris(1-carboxybutan-2-yl)-1,3,2-dioxaborolan-4-yl]pentanoic acid.
| Compound Name | 3-[2-[2-(bromomethyl)-3-cyano-5-nitrophenyl]-4,5,5-tris(1-carboxybutan-2-yl)-1,3,2-dioxaborolan-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 175181327 |
| Molecular Formula | C30H40BBrN2O12 |
| Molecular Weight | 711.37 g/mol |
| Exact Mass | 710.19 |
| IUPAC Name | 3-[2-[2-(bromomethyl)-3-cyano-5-nitrophenyl]-4,5,5-tris(1-carboxybutan-2-yl)-1,3,2-dioxaborolan-4-yl]pentanoic acid |
| SMILES | CCC(CC(=O)O)C1(C(CC)CC(=O)O)OB(c2cc([N+](=O)[O-])cc(C#N)c2CBr)OC1(C(CC)CC(=O)O)C(CC)CC(=O)O |
| InChI | InChI=1S/C30H40BBrN2O12/c1-5-18(10-25(35)36)29(19(6-2)11-26(37)38)30(20(7-3)12-27(39)40,21(8-4)13-28(41)42)46-31(45-29)24-14-22(34(43)44)9-17(16-33)23(24)15-32/h9,14,18-21H,5-8,10-13,15H2,1-4H3,(H,35,36)(H,37,38)(H,39,40)(H,41,42) |
| InChIKey | FXKTUORBSPLDFO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 234.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|