C24H27NO5 — CID 175182769
methyl 2-hydroxy-4-methoxy-6-[2-[1-(4-methylbenzoyl)piperidin-4-yl]ethenyl]benzoate (PubChem CID 175182769) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is methyl 2-hydroxy-4-methoxy-6-[2-[1-(4-methylbenzoyl)piperidin-4-yl]ethenyl]benzoate.
| Compound Name | methyl 2-hydroxy-4-methoxy-6-[2-[1-(4-methylbenzoyl)piperidin-4-yl]ethenyl]benzoate |
|---|---|
| PubChem CID | 175182769 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | methyl 2-hydroxy-4-methoxy-6-[2-[1-(4-methylbenzoyl)piperidin-4-yl]ethenyl]benzoate |
| SMILES | COC(=O)c1c(O)cc(OC)cc1C=CC1CCN(C(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C24H27NO5/c1-16-4-7-18(8-5-16)23(27)25-12-10-17(11-13-25)6-9-19-14-20(29-2)15-21(26)22(19)24(28)30-3/h4-9,14-15,17,26H,10-13H2,1-3H3 |
| InChIKey | WLQPKSGZTANHCU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |