C22H21NO5 — CID 175183974
[2-[[[2-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxy]acetyl]amino]methyl]phenyl] prop-2-enoate (PubChem CID 175183974) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is [2-[[[2-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxy]acetyl]amino]methyl]phenyl] prop-2-enoate.
| Compound Name | [2-[[[2-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxy]acetyl]amino]methyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 175183974 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [2-[[[2-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxy]acetyl]amino]methyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccccc1CNC(=O)COc1ccc2c(c1)CCCC2=O |
| InChI | InChI=1S/C22H21NO5/c1-2-22(26)28-20-9-4-3-6-16(20)13-23-21(25)14-27-17-10-11-18-15(12-17)7-5-8-19(18)24/h2-4,6,9-12H,1,5,7-8,13-14H2,(H,23,25) |
| InChIKey | IBFBWVJFEJQWBH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|