C44H39O2Si — CID 175184222
CID 175184222 (PubChem CID 175184222) has the molecular formula C44H39O2Si and a molecular weight of 627.88 g/mol.
| Compound Name | CID 175184222 |
|---|---|
| PubChem CID | 175184222 |
| Molecular Formula | C44H39O2Si |
| Molecular Weight | 627.88 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C2=Cc3c(cc(C)c(C)c3-c3ccccc3)C2)o1.Cc1ccc(C2=Cc3c(cc(C)c(C)c3-c3ccccc3)C2[Si])o1 |
| InChI | InChI=1S/C22H19OSi.C22H20O/c1-13-11-18-17(21(15(13)3)16-7-5-4-6-8-16)12-19(22(18)24)20-10-9-14(2)23-20;1-14-11-18-12-19(21-10-9-15(2)23-21)13-20(18)22(16(14)3)17-7-5-4-6-8-17/h4-12,22H,1-3H3;4-11,13H,12H2,1-3H3 |
| InChIKey | YQVWNJVFYBPSKY-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.88 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|