About CID 175184222
CID 175184222 (PubChem CID 175184222) has the molecular formula C44H39O2Si
and a molecular weight of 627.88 g/mol.
Molecular Properties
| Compound Name | CID 175184222 |
| PubChem CID | 175184222 |
| Molecular Formula | C44H39O2Si |
| Molecular Weight | 627.88 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C2=Cc3c(cc(C)c(C)c3-c3ccccc3)C2)o1.Cc1ccc(C2=Cc3c(cc(C)c(C)c3-c3ccccc3)C2[Si])o1 |
| InChI | InChI=1S/C22H19OSi.C22H20O/c1-13-11-18-17(21(15(13)3)16-7-5-4-6-8-16)12-19(22(18)24)20-10-9-14(2)23-20;1-14-11-18-12-19(21-10-9-15(2)23-21)13-20(18)22(16(14)3)17-7-5-4-6-8-17/h4-12,22H,1-3H3;4-11,13H,12H2,1-3H3 |
| InChIKey | YQVWNJVFYBPSKY-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 627.88 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175184222 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175184222?
The IUPAC name of CID 175184222 (CID 175184222) is not available.
What is the SMILES notation for CID 175184222?
The canonical SMILES for CID 175184222 is Cc1ccc(C2=Cc3c(cc(C)c(C)c3-c3ccccc3)C2)o1.Cc1ccc(C2=Cc3c(cc(C)c(C)c3-c3ccccc3)C2[Si])o1.
What is the InChIKey of CID 175184222?
The InChIKey is YQVWNJVFYBPSKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19OSi.C22H20O/c1-13-11-18-17(21(15(13)3)16-7-5-4-6-8-16)12-19(22(18)24)20-10-9-14(2)23-20;1-14-11-18-12-19(21-10-9-15(2)23-21)13-20(18)22(16(14)3)17-7-5-4-6-8-17/h4-12,22H,1-3H3;4-11,13H,12H2,1-3H3.
What are the key properties of CID 175184222?
CID 175184222 has a molecular weight of 627.88 g/mol, XLogP of 11.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175184222 is sourced from PubChem (CID 175184222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).