C22H18ClN2O3+ — CID 175184523
1-[(3-chloro-4-hydroxyphenyl)methyl]-4-(4-hydroxyphenyl)-3-methylpyrido[1,2-a]pyrimidin-5-ium-2-one (PubChem CID 175184523) has the molecular formula C22H18ClN2O3+ and a molecular weight of 393.85 g/mol. Its IUPAC name is 1-[(3-chloro-4-hydroxyphenyl)methyl]-4-(4-hydroxyphenyl)-3-methylpyrido[1,2-a]pyrimidin-5-ium-2-one.
| Compound Name | 1-[(3-chloro-4-hydroxyphenyl)methyl]-4-(4-hydroxyphenyl)-3-methylpyrido[1,2-a]pyrimidin-5-ium-2-one |
|---|---|
| PubChem CID | 175184523 |
| Molecular Formula | C22H18ClN2O3+ |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 1-[(3-chloro-4-hydroxyphenyl)methyl]-4-(4-hydroxyphenyl)-3-methylpyrido[1,2-a]pyrimidin-5-ium-2-one |
| SMILES | Cc1c(-c2ccc(O)cc2)[n+]2ccccc2n(Cc2ccc(O)c(Cl)c2)c1=O |
| InChI | InChI=1S/C22H17ClN2O3/c1-14-21(16-6-8-17(26)9-7-16)24-11-3-2-4-20(24)25(22(14)28)13-15-5-10-19(27)18(23)12-15/h2-12H,13H2,1H3,(H-,26,27,28)/p+1 |
| InChIKey | HRLWTTBSMZVTNN-UHFFFAOYSA-O |
| XLogP | 3.68 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|