C16H20N2O — CID 175186188
1-but-3-ynyl-3-methoxybenzene;4,5-dimethyl-1H-imidazole (PubChem CID 175186188) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-but-3-ynyl-3-methoxybenzene;4,5-dimethyl-1H-imidazole.
| Compound Name | 1-but-3-ynyl-3-methoxybenzene;4,5-dimethyl-1H-imidazole |
|---|---|
| PubChem CID | 175186188 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1-but-3-ynyl-3-methoxybenzene;4,5-dimethyl-1H-imidazole |
| SMILES | C#CCCc1cccc(OC)c1.Cc1nc[nH]c1C |
| InChI | InChI=1S/C11H12O.C5H8N2/c1-3-4-6-10-7-5-8-11(9-10)12-2;1-4-5(2)7-3-6-4/h1,5,7-9H,4,6H2,2H3;3H,1-2H3,(H,6,7) |
| InChIKey | WUZZWDZSMRMECU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|