C37H39NO2 — CID 175187920
2,2-bis(4-methylphenyl)ethyl 6-cyano-2,2-bis(4-methylphenyl)hexanoate (PubChem CID 175187920) has the molecular formula C37H39NO2 and a molecular weight of 529.72 g/mol. Its IUPAC name is 2,2-bis(4-methylphenyl)ethyl 6-cyano-2,2-bis(4-methylphenyl)hexanoate.
| Compound Name | 2,2-bis(4-methylphenyl)ethyl 6-cyano-2,2-bis(4-methylphenyl)hexanoate |
|---|---|
| PubChem CID | 175187920 |
| Molecular Formula | C37H39NO2 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | 2,2-bis(4-methylphenyl)ethyl 6-cyano-2,2-bis(4-methylphenyl)hexanoate |
| SMILES | Cc1ccc(C(COC(=O)C(CCCCC#N)(c2ccc(C)cc2)c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C37H39NO2/c1-27-8-16-31(17-9-27)35(32-18-10-28(2)11-19-32)26-40-36(39)37(24-6-5-7-25-38,33-20-12-29(3)13-21-33)34-22-14-30(4)15-23-34/h8-23,35H,5-7,24,26H2,1-4H3 |
| InChIKey | BCZSDSXVLSIWHB-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|