C10H16F2N2O4 — CID 175187949
[(2R)-1-[3-(difluoromethoxy)piperidin-1-yl]-1-oxopropan-2-yl] carbamate (PubChem CID 175187949) has the molecular formula C10H16F2N2O4 and a molecular weight of 266.24 g/mol. Its IUPAC name is [(2R)-1-[3-(difluoromethoxy)piperidin-1-yl]-1-oxopropan-2-yl] carbamate.
| Compound Name | [(2R)-1-[3-(difluoromethoxy)piperidin-1-yl]-1-oxopropan-2-yl] carbamate |
|---|---|
| PubChem CID | 175187949 |
| Molecular Formula | C10H16F2N2O4 |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | [(2R)-1-[3-(difluoromethoxy)piperidin-1-yl]-1-oxopropan-2-yl] carbamate |
| SMILES | C[C@@H](OC(N)=O)C(=O)N1CCCC(OC(F)F)C1 |
| InChI | InChI=1S/C10H16F2N2O4/c1-6(17-10(13)16)8(15)14-4-2-3-7(5-14)18-9(11)12/h6-7,9H,2-5H2,1H3,(H2,13,16)/t6-,7?/m1/s1 |
| InChIKey | GLWXDBBMPFTNAM-ULUSZKPHSA-N |
| XLogP | 0.70 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |