C11H21N3O3 — CID 175284066
[1-[4-(1-aminoethyl)piperidin-1-yl]-1-oxopropan-2-yl] carbamate (PubChem CID 175284066) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is [1-[4-(1-aminoethyl)piperidin-1-yl]-1-oxopropan-2-yl] carbamate.
| Compound Name | [1-[4-(1-aminoethyl)piperidin-1-yl]-1-oxopropan-2-yl] carbamate |
|---|---|
| PubChem CID | 175284066 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | [1-[4-(1-aminoethyl)piperidin-1-yl]-1-oxopropan-2-yl] carbamate |
| SMILES | CC(OC(N)=O)C(=O)N1CCC(C(C)N)CC1 |
| InChI | InChI=1S/C11H21N3O3/c1-7(12)9-3-5-14(6-4-9)10(15)8(2)17-11(13)16/h7-9H,3-6,12H2,1-2H3,(H2,13,16) |
| InChIKey | JPEXSMANBAUMNF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |