About methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate
methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate (PubChem CID 175189978) has the molecular formula C17H25NO6S
and a molecular weight of 371.46 g/mol. Its IUPAC name is methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate.
Molecular Properties
| Compound Name | methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate |
| PubChem CID | 175189978 |
| Molecular Formula | C17H25NO6S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate |
| SMILES | CCOc1cc([C@@H]2C[C@H](CS(=O)(=O)OC)N(C(C)=O)C2)ccc1OC |
| InChI | InChI=1S/C17H25NO6S/c1-5-24-17-9-13(6-7-16(17)22-3)14-8-15(11-25(20,21)23-4)18(10-14)12(2)19/h6-7,9,14-15H,5,8,10-11H2,1-4H3/t14-,15-/m1/s1 |
| InChIKey | VVBGDRQFKGKXCA-HUUCEWRRSA-N |
| XLogP | 1.77 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate?
The IUPAC name of methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate (CID 175189978) is methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate.
What is the SMILES notation for methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate?
The canonical SMILES for methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate is CCOc1cc([C@@H]2C[C@H](CS(=O)(=O)OC)N(C(C)=O)C2)ccc1OC.
What is the InChIKey of methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate?
The InChIKey is VVBGDRQFKGKXCA-HUUCEWRRSA-N. The full InChI is InChI=1S/C17H25NO6S/c1-5-24-17-9-13(6-7-16(17)22-3)14-8-15(11-25(20,21)23-4)18(10-14)12(2)19/h6-7,9,14-15H,5,8,10-11H2,1-4H3/t14-,15-/m1/s1.
What are the key properties of methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate?
methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate has a molecular weight of 371.46 g/mol, XLogP of 1.77, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate is sourced from PubChem (CID 175189978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).