C17H25NO6S — CID 175189978
methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate (PubChem CID 175189978) has the molecular formula C17H25NO6S and a molecular weight of 371.46 g/mol. Its IUPAC name is methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate.
| Compound Name | methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate |
|---|---|
| PubChem CID | 175189978 |
| Molecular Formula | C17H25NO6S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | methyl [(2R,4S)-1-acetyl-4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-yl]methanesulfonate |
| SMILES | CCOc1cc([C@@H]2C[C@H](CS(=O)(=O)OC)N(C(C)=O)C2)ccc1OC |
| InChI | InChI=1S/C17H25NO6S/c1-5-24-17-9-13(6-7-16(17)22-3)14-8-15(11-25(20,21)23-4)18(10-14)12(2)19/h6-7,9,14-15H,5,8,10-11H2,1-4H3/t14-,15-/m1/s1 |
| InChIKey | VVBGDRQFKGKXCA-HUUCEWRRSA-N |
| XLogP | 1.77 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|