C20H25N3O4 — CID 175190623
3-[3-[acetyl(methyl)amino]phenyl]-2-[(4-cyanocyclohexanecarbonyl)amino]propanoic acid (PubChem CID 175190623) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-[3-[acetyl(methyl)amino]phenyl]-2-[(4-cyanocyclohexanecarbonyl)amino]propanoic acid.
| Compound Name | 3-[3-[acetyl(methyl)amino]phenyl]-2-[(4-cyanocyclohexanecarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 175190623 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3-[3-[acetyl(methyl)amino]phenyl]-2-[(4-cyanocyclohexanecarbonyl)amino]propanoic acid |
| SMILES | CC(=O)N(C)c1cccc(CC(NC(=O)C2CCC(C#N)CC2)C(=O)O)c1 |
| InChI | InChI=1S/C20H25N3O4/c1-13(24)23(2)17-5-3-4-15(10-17)11-18(20(26)27)22-19(25)16-8-6-14(12-21)7-9-16/h3-5,10,14,16,18H,6-9,11H2,1-2H3,(H,22,25)(H,26,27) |
| InChIKey | IMSLUQWAZRTBJQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |