C11H21NO2 — CID 175190936
3,3-dimethyl-2-methylidene-N-[(2-methylpropan-2-yl)oxy]butanamide (PubChem CID 175190936) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 3,3-dimethyl-2-methylidene-N-[(2-methylpropan-2-yl)oxy]butanamide.
| Compound Name | 3,3-dimethyl-2-methylidene-N-[(2-methylpropan-2-yl)oxy]butanamide |
|---|---|
| PubChem CID | 175190936 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 3,3-dimethyl-2-methylidene-N-[(2-methylpropan-2-yl)oxy]butanamide |
| SMILES | C=C(C(=O)NOC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-8(10(2,3)4)9(13)12-14-11(5,6)7/h1H2,2-7H3,(H,12,13) |
| InChIKey | IEGZYMFKNPAZMO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|