C41H32Cl2O2Zr — CID 175193982
dichlorozirconium(2+);2-methyl-5-(5-methyl-4-phenyl-1H-inden-1-id-2-yl)furan;2-methyl-5-(4-phenyl-1H-inden-1-id-2-yl)furan (PubChem CID 175193982) has the molecular formula C41H32Cl2O2Zr and a molecular weight of 718.84 g/mol. Its IUPAC name is dichlorozirconium(2+);2-methyl-5-(5-methyl-4-phenyl-1H-inden-1-id-2-yl)furan;2-methyl-5-(4-phenyl-1H-inden-1-id-2-yl)furan.
| Compound Name | dichlorozirconium(2+);2-methyl-5-(5-methyl-4-phenyl-1H-inden-1-id-2-yl)furan;2-methyl-5-(4-phenyl-1H-inden-1-id-2-yl)furan |
|---|---|
| PubChem CID | 175193982 |
| Molecular Formula | C41H32Cl2O2Zr |
| Molecular Weight | 718.84 g/mol |
| Exact Mass | 716.08 |
| IUPAC Name | dichlorozirconium(2+);2-methyl-5-(5-methyl-4-phenyl-1H-inden-1-id-2-yl)furan;2-methyl-5-(4-phenyl-1H-inden-1-id-2-yl)furan |
| SMILES | Cc1ccc(-c2cc3c(-c4ccccc4)c(C)ccc3[cH-]2)o1.Cc1ccc(-c2cc3c(-c4ccccc4)cccc3[cH-]2)o1.Cl[Zr+2]Cl |
| InChI | InChI=1S/C21H17O.C20H15O.2ClH.Zr/c1-14-8-10-17-12-18(20-11-9-15(2)22-20)13-19(17)21(14)16-6-4-3-5-7-16;1-14-10-11-20(21-14)17-12-16-8-5-9-18(19(16)13-17)15-6-3-2-4-7-15;;;/h3-13H,1-2H3;2-13H,1H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | MGTAUYZIUMFHJN-UHFFFAOYSA-L |
| XLogP | 13.27 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.84 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|