C29H28ClN3O3 — CID 175195517
9H-fluoren-9-yl N-[(2S)-1-[amino(methyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-N-methylcarbamate;hydrochloride (PubChem CID 175195517) has the molecular formula C29H28ClN3O3 and a molecular weight of 502.01 g/mol. Its IUPAC name is 9H-fluoren-9-yl N-[(2S)-1-[amino(methyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-N-methylcarbamate;hydrochloride.
| Compound Name | 9H-fluoren-9-yl N-[(2S)-1-[amino(methyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-N-methylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 175195517 |
| Molecular Formula | C29H28ClN3O3 |
| Molecular Weight | 502.01 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 9H-fluoren-9-yl N-[(2S)-1-[amino(methyl)amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-N-methylcarbamate;hydrochloride |
| SMILES | CN(N)C(=O)[C@H](Cc1ccc2ccccc2c1)N(C)C(=O)OC1c2ccccc2-c2ccccc21.Cl |
| InChI | InChI=1S/C29H27N3O3.ClH/c1-31(26(28(33)32(2)30)18-19-15-16-20-9-3-4-10-21(20)17-19)29(34)35-27-24-13-7-5-11-22(24)23-12-6-8-14-25(23)27;/h3-17,26-27H,18,30H2,1-2H3;1H/t26-;/m0./s1 |
| InChIKey | AMWMEZQXXKMAOZ-SNYZSRNZSA-N |
| XLogP | 5.34 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.01 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|