C16H24N2 — CID 175197217
N-[2-(3-methylpyrrolidin-3-yl)ethyl]-2-phenylcyclopropan-1-amine (PubChem CID 175197217) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-[2-(3-methylpyrrolidin-3-yl)ethyl]-2-phenylcyclopropan-1-amine.
| Compound Name | N-[2-(3-methylpyrrolidin-3-yl)ethyl]-2-phenylcyclopropan-1-amine |
|---|---|
| PubChem CID | 175197217 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-[2-(3-methylpyrrolidin-3-yl)ethyl]-2-phenylcyclopropan-1-amine |
| SMILES | CC1(CCNC2CC2c2ccccc2)CCNC1 |
| InChI | InChI=1S/C16H24N2/c1-16(7-9-17-12-16)8-10-18-15-11-14(15)13-5-3-2-4-6-13/h2-6,14-15,17-18H,7-12H2,1H3 |
| InChIKey | UJNBGHBNHKPOKM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |