C11H14ClN — CID 67064917
trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine (PubChem CID 67064917) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine.
| Compound Name | trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine |
|---|---|
| PubChem CID | 67064917 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine |
| SMILES | ClCCN[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H14ClN/c12-6-7-13-11-8-10(11)9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2/t10-,11+/m0/s1 |
| InChIKey | UXILYVCUBVSGOI-WDEREUQCSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|