About trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine
trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine (PubChem CID 67064917) has the molecular formula C11H14ClN
and a molecular weight of 195.69 g/mol. Its IUPAC name is trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine.
Molecular Properties
| Compound Name | trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine |
| PubChem CID | 67064917 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine |
| SMILES | ClCCN[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H14ClN/c12-6-7-13-11-8-10(11)9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2/t10-,11+/m0/s1 |
| InChIKey | UXILYVCUBVSGOI-WDEREUQCSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine?
The IUPAC name of trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine (CID 67064917) is trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine.
What is the SMILES notation for trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine?
The canonical SMILES for trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine is ClCCN[C@@H]1C[C@H]1c1ccccc1.
What is the InChIKey of trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine?
The InChIKey is UXILYVCUBVSGOI-WDEREUQCSA-N. The full InChI is InChI=1S/C11H14ClN/c12-6-7-13-11-8-10(11)9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2/t10-,11+/m0/s1.
What are the key properties of trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine?
trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine has a molecular weight of 195.69 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2S)-N-(2-chloroethyl)-2-phenylcyclopropan-1-amine is sourced from PubChem (CID 67064917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).