C21H21FN4O4 — CID 175198415
4-[1-[[1-[2-(4-fluorophenoxy)ethyl]-5-methyltriazole-4-carbonyl]amino]ethyl]benzoic acid (PubChem CID 175198415) has the molecular formula C21H21FN4O4 and a molecular weight of 412.42 g/mol. Its IUPAC name is 4-[1-[[1-[2-(4-fluorophenoxy)ethyl]-5-methyltriazole-4-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[1-[[1-[2-(4-fluorophenoxy)ethyl]-5-methyltriazole-4-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 175198415 |
| Molecular Formula | C21H21FN4O4 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-[1-[[1-[2-(4-fluorophenoxy)ethyl]-5-methyltriazole-4-carbonyl]amino]ethyl]benzoic acid |
| SMILES | Cc1c(C(=O)NC(C)c2ccc(C(=O)O)cc2)nnn1CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN4O4/c1-13(15-3-5-16(6-4-15)21(28)29)23-20(27)19-14(2)26(25-24-19)11-12-30-18-9-7-17(22)8-10-18/h3-10,13H,11-12H2,1-2H3,(H,23,27)(H,28,29) |
| InChIKey | FXNFKMCKURSBPI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |