C13H18N4O3 — CID 175198510
2-N,2-N-dimethyl-4-morpholin-4-ylpyridine-2,5-dicarboxamide (PubChem CID 175198510) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-4-morpholin-4-ylpyridine-2,5-dicarboxamide.
| Compound Name | 2-N,2-N-dimethyl-4-morpholin-4-ylpyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 175198510 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-N,2-N-dimethyl-4-morpholin-4-ylpyridine-2,5-dicarboxamide |
| SMILES | CN(C)C(=O)c1cc(N2CCOCC2)c(C(N)=O)cn1 |
| InChI | InChI=1S/C13H18N4O3/c1-16(2)13(19)10-7-11(9(8-15-10)12(14)18)17-3-5-20-6-4-17/h7-8H,3-6H2,1-2H3,(H2,14,18) |
| InChIKey | KEGYQEXHWLKQSH-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |