C14H19FN2O2 — CID 23156760
2-fluoro-N,N,6-trimethyl-3-morpholin-4-ylbenzamide (PubChem CID 23156760) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-fluoro-N,N,6-trimethyl-3-morpholin-4-ylbenzamide.
| Compound Name | 2-fluoro-N,N,6-trimethyl-3-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 23156760 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-fluoro-N,N,6-trimethyl-3-morpholin-4-ylbenzamide |
| SMILES | Cc1ccc(N2CCOCC2)c(F)c1C(=O)N(C)C |
| InChI | InChI=1S/C14H19FN2O2/c1-10-4-5-11(17-6-8-19-9-7-17)13(15)12(10)14(18)16(2)3/h4-5H,6-9H2,1-3H3 |
| InChIKey | DQLAZAWQXTXSSX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |