C19H14FN3O — CID 175202056
2-[5-(6-ethynyl-4-methyl-3-pyridinyl)-2-fluorophenoxy]-4-methylpyrimidine (PubChem CID 175202056) has the molecular formula C19H14FN3O and a molecular weight of 319.34 g/mol. Its IUPAC name is 2-[5-(6-ethynyl-4-methyl-3-pyridinyl)-2-fluorophenoxy]-4-methylpyrimidine.
| Compound Name | 2-[5-(6-ethynyl-4-methyl-3-pyridinyl)-2-fluorophenoxy]-4-methylpyrimidine |
|---|---|
| PubChem CID | 175202056 |
| Molecular Formula | C19H14FN3O |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-[5-(6-ethynyl-4-methyl-3-pyridinyl)-2-fluorophenoxy]-4-methylpyrimidine |
| SMILES | C#Cc1cc(C)c(-c2ccc(F)c(Oc3nccc(C)n3)c2)cn1 |
| InChI | InChI=1S/C19H14FN3O/c1-4-15-9-12(2)16(11-22-15)14-5-6-17(20)18(10-14)24-19-21-8-7-13(3)23-19/h1,5-11H,2-3H3 |
| InChIKey | XPJPMJZKMFDWGP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|