C8H14N2O3 — CID 175205498
(3E)-3-(dimethylaminomethylidene)-4-hydroxypyrrolidine-1-carboxylic acid (PubChem CID 175205498) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is (3E)-3-(dimethylaminomethylidene)-4-hydroxypyrrolidine-1-carboxylic acid.
| Compound Name | (3E)-3-(dimethylaminomethylidene)-4-hydroxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175205498 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (3E)-3-(dimethylaminomethylidene)-4-hydroxypyrrolidine-1-carboxylic acid |
| SMILES | CN(C)/C=C1\CN(C(=O)O)CC1O |
| InChI | InChI=1S/C8H14N2O3/c1-9(2)3-6-4-10(8(12)13)5-7(6)11/h3,7,11H,4-5H2,1-2H3,(H,12,13)/b6-3+ |
| InChIKey | MAXJQMDPQYYJPC-ZZXKWVIFSA-N |
| XLogP | -0.21 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |