C7H12N2O3 — CID 177212552
(2R)-2,4-dimethyl-5-oxopiperazine-1-carboxylic acid (PubChem CID 177212552) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is (2R)-2,4-dimethyl-5-oxopiperazine-1-carboxylic acid.
| Compound Name | (2R)-2,4-dimethyl-5-oxopiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 177212552 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | (2R)-2,4-dimethyl-5-oxopiperazine-1-carboxylic acid |
| SMILES | C[C@@H]1CN(C)C(=O)CN1C(=O)O |
| InChI | InChI=1S/C7H12N2O3/c1-5-3-8(2)6(10)4-9(5)7(11)12/h5H,3-4H2,1-2H3,(H,11,12)/t5-/m1/s1 |
| InChIKey | ACDMGXURLXSTAP-RXMQYKEDSA-N |
| XLogP | -0.17 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |