C22H29BrFNO5 — CID 175208654
tert-butyl 2-[4-bromo-2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-5-fluorophenoxy]-2-cyclopropylacetate (PubChem CID 175208654) has the molecular formula C22H29BrFNO5 and a molecular weight of 486.38 g/mol. Its IUPAC name is tert-butyl 2-[4-bromo-2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-5-fluorophenoxy]-2-cyclopropylacetate.
| Compound Name | tert-butyl 2-[4-bromo-2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-5-fluorophenoxy]-2-cyclopropylacetate |
|---|---|
| PubChem CID | 175208654 |
| Molecular Formula | C22H29BrFNO5 |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | tert-butyl 2-[4-bromo-2-(4-butoxy-4,5-dihydro-1,2-oxazol-3-yl)-5-fluorophenoxy]-2-cyclopropylacetate |
| SMILES | CCCCOC1CON=C1c1cc(Br)c(F)cc1OC(C(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C22H29BrFNO5/c1-5-6-9-27-18-12-28-25-19(18)14-10-15(23)16(24)11-17(14)29-20(13-7-8-13)21(26)30-22(2,3)4/h10-11,13,18,20H,5-9,12H2,1-4H3 |
| InChIKey | NBRBKVFWJJEYQP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|