C12H9F3N4O5 — CID 175209230
3-amino-4-[4-azido-2-(trifluoromethyl)benzoyl]oxy-4-oxobutanoic acid (PubChem CID 175209230) has the molecular formula C12H9F3N4O5 and a molecular weight of 346.22 g/mol. Its IUPAC name is 3-amino-4-[4-azido-2-(trifluoromethyl)benzoyl]oxy-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[4-azido-2-(trifluoromethyl)benzoyl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175209230 |
| Molecular Formula | C12H9F3N4O5 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 3-amino-4-[4-azido-2-(trifluoromethyl)benzoyl]oxy-4-oxobutanoic acid |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)OC(=O)C(N)CC(=O)O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H9F3N4O5/c13-12(14,15)7-3-5(18-19-17)1-2-6(7)10(22)24-11(23)8(16)4-9(20)21/h1-3,8H,4,16H2,(H,20,21) |
| InChIKey | XMCFCDAOAJSZSU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 155.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|